C18H30N6O3 — CID 67374963
4-N,5-N,6-N-tributyltriazine-4,5,6-tricarboxamide (PubChem CID 67374963) has the molecular formula C18H30N6O3 and a molecular weight of 378.48 g/mol. Its IUPAC name is 4-N,5-N,6-N-tributyltriazine-4,5,6-tricarboxamide.
| Compound Name | 4-N,5-N,6-N-tributyltriazine-4,5,6-tricarboxamide |
|---|---|
| PubChem CID | 67374963 |
| Molecular Formula | C18H30N6O3 |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | 4-N,5-N,6-N-tributyltriazine-4,5,6-tricarboxamide |
| SMILES | CCCCNC(=O)c1nnnc(C(=O)NCCCC)c1C(=O)NCCCC |
| InChI | InChI=1S/C18H30N6O3/c1-4-7-10-19-16(25)13-14(17(26)20-11-8-5-2)22-24-23-15(13)18(27)21-12-9-6-3/h4-12H2,1-3H3,(H,19,25)(H,20,26)(H,21,27) |
| InChIKey | UWZTVFZPYMJAKZ-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 125.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|