About 4-N,5-N-dibutyl-1H-imidazole-4,5-dicarboxamide
4-N,5-N-dibutyl-1H-imidazole-4,5-dicarboxamide (PubChem CID 551896) has the molecular formula C13H22N4O2
and a molecular weight of 266.34 g/mol. Its IUPAC name is 4-N,5-N-dibutyl-1H-imidazole-4,5-dicarboxamide.
Molecular Properties
| Compound Name | 4-N,5-N-dibutyl-1H-imidazole-4,5-dicarboxamide |
| PubChem CID | 551896 |
| Molecular Formula | C13H22N4O2 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | 4-N,5-N-dibutyl-1H-imidazole-4,5-dicarboxamide |
| SMILES | CCCCNC(=O)c1nc[nH]c1C(=O)NCCCC |
| InChI | InChI=1S/C13H22N4O2/c1-3-5-7-14-12(18)10-11(17-9-16-10)13(19)15-8-6-4-2/h9H,3-8H2,1-2H3,(H,14,18)(H,15,19)(H,16,17) |
| InChIKey | QVIQJOLYGPTMSX-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-N,5-N-dibutyl-1H-imidazole-4,5-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-N,5-N-dibutyl-1H-imidazole-4,5-dicarboxamide?
The IUPAC name of 4-N,5-N-dibutyl-1H-imidazole-4,5-dicarboxamide (CID 551896) is 4-N,5-N-dibutyl-1H-imidazole-4,5-dicarboxamide.
What is the SMILES notation for 4-N,5-N-dibutyl-1H-imidazole-4,5-dicarboxamide?
The canonical SMILES for 4-N,5-N-dibutyl-1H-imidazole-4,5-dicarboxamide is CCCCNC(=O)c1nc[nH]c1C(=O)NCCCC.
What is the InChIKey of 4-N,5-N-dibutyl-1H-imidazole-4,5-dicarboxamide?
The InChIKey is QVIQJOLYGPTMSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22N4O2/c1-3-5-7-14-12(18)10-11(17-9-16-10)13(19)15-8-6-4-2/h9H,3-8H2,1-2H3,(H,14,18)(H,15,19)(H,16,17).
What are the key properties of 4-N,5-N-dibutyl-1H-imidazole-4,5-dicarboxamide?
4-N,5-N-dibutyl-1H-imidazole-4,5-dicarboxamide has a molecular weight of 266.34 g/mol, XLogP of 1.47, 8 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-N,5-N-dibutyl-1H-imidazole-4,5-dicarboxamide is sourced from PubChem (CID 551896), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).