C14H21N3O3S — CID 74232219
4-(3-cyclohexylsulfanylpropylcarbamoyl)-1H-imidazole-5-carboxylic acid (PubChem CID 74232219) has the molecular formula C14H21N3O3S and a molecular weight of 311.41 g/mol. Its IUPAC name is 4-(3-cyclohexylsulfanylpropylcarbamoyl)-1H-imidazole-5-carboxylic acid.
| Compound Name | 4-(3-cyclohexylsulfanylpropylcarbamoyl)-1H-imidazole-5-carboxylic acid |
|---|---|
| PubChem CID | 74232219 |
| Molecular Formula | C14H21N3O3S |
| Molecular Weight | 311.41 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | 4-(3-cyclohexylsulfanylpropylcarbamoyl)-1H-imidazole-5-carboxylic acid |
| SMILES | O=C(NCCCSC1CCCCC1)c1nc[nH]c1C(=O)O |
| InChI | InChI=1S/C14H21N3O3S/c18-13(11-12(14(19)20)17-9-16-11)15-7-4-8-21-10-5-2-1-3-6-10/h9-10H,1-8H2,(H,15,18)(H,16,17)(H,19,20) |
| InChIKey | LCHPWAFAHUFIDC-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.41 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|