C10H13N3O3S — CID 107295054
4-(thiolan-3-ylmethylcarbamoyl)-1H-imidazole-5-carboxylic acid (PubChem CID 107295054) has the molecular formula C10H13N3O3S and a molecular weight of 255.30 g/mol. Its IUPAC name is 4-(thiolan-3-ylmethylcarbamoyl)-1H-imidazole-5-carboxylic acid.
| Compound Name | 4-(thiolan-3-ylmethylcarbamoyl)-1H-imidazole-5-carboxylic acid |
|---|---|
| PubChem CID | 107295054 |
| Molecular Formula | C10H13N3O3S |
| Molecular Weight | 255.30 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | 4-(thiolan-3-ylmethylcarbamoyl)-1H-imidazole-5-carboxylic acid |
| SMILES | O=C(NCC1CCSC1)c1nc[nH]c1C(=O)O |
| InChI | InChI=1S/C10H13N3O3S/c14-9(11-3-6-1-2-17-4-6)7-8(10(15)16)13-5-12-7/h5-6H,1-4H2,(H,11,14)(H,12,13)(H,15,16) |
| InChIKey | GHMDTPJRFNBJLO-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.30 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |