C12H18N4O5S — CID 77078744
4-[(1-methylsulfonylpiperidin-3-yl)methylcarbamoyl]-1H-imidazole-5-carboxylic acid (PubChem CID 77078744) has the molecular formula C12H18N4O5S and a molecular weight of 330.37 g/mol. Its IUPAC name is 4-[(1-methylsulfonylpiperidin-3-yl)methylcarbamoyl]-1H-imidazole-5-carboxylic acid.
| Compound Name | 4-[(1-methylsulfonylpiperidin-3-yl)methylcarbamoyl]-1H-imidazole-5-carboxylic acid |
|---|---|
| PubChem CID | 77078744 |
| Molecular Formula | C12H18N4O5S |
| Molecular Weight | 330.37 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | 4-[(1-methylsulfonylpiperidin-3-yl)methylcarbamoyl]-1H-imidazole-5-carboxylic acid |
| SMILES | CS(=O)(=O)N1CCCC(CNC(=O)c2nc[nH]c2C(=O)O)C1 |
| InChI | InChI=1S/C12H18N4O5S/c1-22(20,21)16-4-2-3-8(6-16)5-13-11(17)9-10(12(18)19)15-7-14-9/h7-8H,2-6H2,1H3,(H,13,17)(H,14,15)(H,18,19) |
| InChIKey | UXMDFIRBGLKLSF-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 132.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.37 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |