C15H24N2O3S — CID 79612346
N-[(1-methylsulfonylpiperidin-3-yl)methyl]-2-phenoxyethanamine (PubChem CID 79612346) has the molecular formula C15H24N2O3S and a molecular weight of 312.43 g/mol. Its IUPAC name is N-[(1-methylsulfonylpiperidin-3-yl)methyl]-2-phenoxyethanamine.
| Compound Name | N-[(1-methylsulfonylpiperidin-3-yl)methyl]-2-phenoxyethanamine |
|---|---|
| PubChem CID | 79612346 |
| Molecular Formula | C15H24N2O3S |
| Molecular Weight | 312.43 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | N-[(1-methylsulfonylpiperidin-3-yl)methyl]-2-phenoxyethanamine |
| SMILES | CS(=O)(=O)N1CCCC(CNCCOc2ccccc2)C1 |
| InChI | InChI=1S/C15H24N2O3S/c1-21(18,19)17-10-5-6-14(13-17)12-16-9-11-20-15-7-3-2-4-8-15/h2-4,7-8,14,16H,5-6,9-13H2,1H3 |
| InChIKey | OAIUDVTVMRFZCP-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.43 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|