C15H23FN2O2S — CID 79613090
2-(2-fluorophenyl)-N-[(1-methylsulfonylpiperidin-3-yl)methyl]ethanamine (PubChem CID 79613090) has the molecular formula C15H23FN2O2S and a molecular weight of 314.43 g/mol. Its IUPAC name is 2-(2-fluorophenyl)-N-[(1-methylsulfonylpiperidin-3-yl)methyl]ethanamine.
| Compound Name | 2-(2-fluorophenyl)-N-[(1-methylsulfonylpiperidin-3-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 79613090 |
| Molecular Formula | C15H23FN2O2S |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | 2-(2-fluorophenyl)-N-[(1-methylsulfonylpiperidin-3-yl)methyl]ethanamine |
| SMILES | CS(=O)(=O)N1CCCC(CNCCc2ccccc2F)C1 |
| InChI | InChI=1S/C15H23FN2O2S/c1-21(19,20)18-10-4-5-13(12-18)11-17-9-8-14-6-2-3-7-15(14)16/h2-3,6-7,13,17H,4-5,8-12H2,1H3 |
| InChIKey | LJTYGIRRDOIXBL-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|