C14H22FN3O2S — CID 106059384
3-(aminomethyl)-N-[2-(2-fluorophenyl)ethyl]piperidine-1-sulfonamide (PubChem CID 106059384) has the molecular formula C14H22FN3O2S and a molecular weight of 315.41 g/mol. Its IUPAC name is 3-(aminomethyl)-N-[2-(2-fluorophenyl)ethyl]piperidine-1-sulfonamide.
| Compound Name | 3-(aminomethyl)-N-[2-(2-fluorophenyl)ethyl]piperidine-1-sulfonamide |
|---|---|
| PubChem CID | 106059384 |
| Molecular Formula | C14H22FN3O2S |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | 3-(aminomethyl)-N-[2-(2-fluorophenyl)ethyl]piperidine-1-sulfonamide |
| SMILES | NCC1CCCN(S(=O)(=O)NCCc2ccccc2F)C1 |
| InChI | InChI=1S/C14H22FN3O2S/c15-14-6-2-1-5-13(14)7-8-17-21(19,20)18-9-3-4-12(10-16)11-18/h1-2,5-6,12,17H,3-4,7-11,16H2 |
| InChIKey | CSBNVSQDHLXZEB-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |