C14H32N4O2S — CID 106040996
3-(aminomethyl)-N-[2-[di(propan-2-yl)amino]ethyl]piperidine-1-sulfonamide (PubChem CID 106040996) has the molecular formula C14H32N4O2S and a molecular weight of 320.50 g/mol. Its IUPAC name is 3-(aminomethyl)-N-[2-[di(propan-2-yl)amino]ethyl]piperidine-1-sulfonamide.
| Compound Name | 3-(aminomethyl)-N-[2-[di(propan-2-yl)amino]ethyl]piperidine-1-sulfonamide |
|---|---|
| PubChem CID | 106040996 |
| Molecular Formula | C14H32N4O2S |
| Molecular Weight | 320.50 g/mol |
| Exact Mass | 320.22 |
| IUPAC Name | 3-(aminomethyl)-N-[2-[di(propan-2-yl)amino]ethyl]piperidine-1-sulfonamide |
| SMILES | CC(C)N(CCNS(=O)(=O)N1CCCC(CN)C1)C(C)C |
| InChI | InChI=1S/C14H32N4O2S/c1-12(2)18(13(3)4)9-7-16-21(19,20)17-8-5-6-14(10-15)11-17/h12-14,16H,5-11,15H2,1-4H3 |
| InChIKey | MKCCTMXMPIMGCC-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.50 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |