C11H25N3O3S — CID 114134691
N-[2-[ethyl(methyl)amino]ethyl]-3-(hydroxymethyl)piperidine-1-sulfonamide (PubChem CID 114134691) has the molecular formula C11H25N3O3S and a molecular weight of 279.41 g/mol. Its IUPAC name is N-[2-[ethyl(methyl)amino]ethyl]-3-(hydroxymethyl)piperidine-1-sulfonamide.
| Compound Name | N-[2-[ethyl(methyl)amino]ethyl]-3-(hydroxymethyl)piperidine-1-sulfonamide |
|---|---|
| PubChem CID | 114134691 |
| Molecular Formula | C11H25N3O3S |
| Molecular Weight | 279.41 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | N-[2-[ethyl(methyl)amino]ethyl]-3-(hydroxymethyl)piperidine-1-sulfonamide |
| SMILES | CCN(C)CCNS(=O)(=O)N1CCCC(CO)C1 |
| InChI | InChI=1S/C11H25N3O3S/c1-3-13(2)8-6-12-18(16,17)14-7-4-5-11(9-14)10-15/h11-12,15H,3-10H2,1-2H3 |
| InChIKey | COYVTQQCLDNTTE-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.41 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |