C14H28N2O4S — CID 79610716
4-methyl-6-[(1-methylsulfonylpiperidin-3-yl)methylamino]hexanoic acid (PubChem CID 79610716) has the molecular formula C14H28N2O4S and a molecular weight of 320.46 g/mol. Its IUPAC name is 4-methyl-6-[(1-methylsulfonylpiperidin-3-yl)methylamino]hexanoic acid.
| Compound Name | 4-methyl-6-[(1-methylsulfonylpiperidin-3-yl)methylamino]hexanoic acid |
|---|---|
| PubChem CID | 79610716 |
| Molecular Formula | C14H28N2O4S |
| Molecular Weight | 320.46 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | 4-methyl-6-[(1-methylsulfonylpiperidin-3-yl)methylamino]hexanoic acid |
| SMILES | CC(CCNCC1CCCN(S(C)(=O)=O)C1)CCC(=O)O |
| InChI | InChI=1S/C14H28N2O4S/c1-12(5-6-14(17)18)7-8-15-10-13-4-3-9-16(11-13)21(2,19)20/h12-13,15H,3-11H2,1-2H3,(H,17,18) |
| InChIKey | HYDUJLYQXPVPBY-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.46 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|