C12H26N2O3S — CID 79613327
3-methyl-4-[(1-methylsulfonylpiperidin-3-yl)methylamino]butan-1-ol (PubChem CID 79613327) has the molecular formula C12H26N2O3S and a molecular weight of 278.42 g/mol. Its IUPAC name is 3-methyl-4-[(1-methylsulfonylpiperidin-3-yl)methylamino]butan-1-ol.
| Compound Name | 3-methyl-4-[(1-methylsulfonylpiperidin-3-yl)methylamino]butan-1-ol |
|---|---|
| PubChem CID | 79613327 |
| Molecular Formula | C12H26N2O3S |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | 3-methyl-4-[(1-methylsulfonylpiperidin-3-yl)methylamino]butan-1-ol |
| SMILES | CC(CCO)CNCC1CCCN(S(C)(=O)=O)C1 |
| InChI | InChI=1S/C12H26N2O3S/c1-11(5-7-15)8-13-9-12-4-3-6-14(10-12)18(2,16)17/h11-13,15H,3-10H2,1-2H3 |
| InChIKey | NHGOUHQAWDDBBV-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |