C12H26N2O3S — CID 79611765
(2S)-3-methyl-2-[(1-methylsulfonylpiperidin-3-yl)methylamino]butan-1-ol (PubChem CID 79611765) has the molecular formula C12H26N2O3S and a molecular weight of 278.42 g/mol. Its IUPAC name is (2S)-3-methyl-2-[(1-methylsulfonylpiperidin-3-yl)methylamino]butan-1-ol.
| Compound Name | (2S)-3-methyl-2-[(1-methylsulfonylpiperidin-3-yl)methylamino]butan-1-ol |
|---|---|
| PubChem CID | 79611765 |
| Molecular Formula | C12H26N2O3S |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | (2S)-3-methyl-2-[(1-methylsulfonylpiperidin-3-yl)methylamino]butan-1-ol |
| SMILES | CC(C)[C@@H](CO)NCC1CCCN(S(C)(=O)=O)C1 |
| InChI | InChI=1S/C12H26N2O3S/c1-10(2)12(9-15)13-7-11-5-4-6-14(8-11)18(3,16)17/h10-13,15H,4-9H2,1-3H3/t11?,12-/m1/s1 |
| InChIKey | WGWIBFLTCWSYQW-PIJUOVFKSA-N |
| XLogP | 0.26 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |