C17H24N4O4S — CID 74235390
1-(2-hydroxyethyl)-N-[(1-methylsulfonylpiperidin-3-yl)methyl]benzimidazole-5-carboxamide (PubChem CID 74235390) has the molecular formula C17H24N4O4S and a molecular weight of 380.47 g/mol. Its IUPAC name is 1-(2-hydroxyethyl)-N-[(1-methylsulfonylpiperidin-3-yl)methyl]benzimidazole-5-carboxamide.
| Compound Name | 1-(2-hydroxyethyl)-N-[(1-methylsulfonylpiperidin-3-yl)methyl]benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 74235390 |
| Molecular Formula | C17H24N4O4S |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | 1-(2-hydroxyethyl)-N-[(1-methylsulfonylpiperidin-3-yl)methyl]benzimidazole-5-carboxamide |
| SMILES | CS(=O)(=O)N1CCCC(CNC(=O)c2ccc3c(c2)ncn3CCO)C1 |
| InChI | InChI=1S/C17H24N4O4S/c1-26(24,25)21-6-2-3-13(11-21)10-18-17(23)14-4-5-16-15(9-14)19-12-20(16)7-8-22/h4-5,9,12-13,22H,2-3,6-8,10-11H2,1H3,(H,18,23) |
| InChIKey | SPXUBXFWEVBEJF-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |