C17H22FN3O3S — CID 99932580
7-fluoro-3-methyl-N-[[(3S)-1-methylsulfonylpiperidin-3-yl]methyl]-1H-indole-2-carboxamide (PubChem CID 99932580) has the molecular formula C17H22FN3O3S and a molecular weight of 367.45 g/mol. Its IUPAC name is 7-fluoro-3-methyl-N-[[(3S)-1-methylsulfonylpiperidin-3-yl]methyl]-1H-indole-2-carboxamide.
| Compound Name | 7-fluoro-3-methyl-N-[[(3S)-1-methylsulfonylpiperidin-3-yl]methyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 99932580 |
| Molecular Formula | C17H22FN3O3S |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | 7-fluoro-3-methyl-N-[[(3S)-1-methylsulfonylpiperidin-3-yl]methyl]-1H-indole-2-carboxamide |
| SMILES | Cc1c(C(=O)NC[C@@H]2CCCN(S(C)(=O)=O)C2)[nH]c2c(F)cccc12 |
| InChI | InChI=1S/C17H22FN3O3S/c1-11-13-6-3-7-14(18)16(13)20-15(11)17(22)19-9-12-5-4-8-21(10-12)25(2,23)24/h3,6-7,12,20H,4-5,8-10H2,1-2H3,(H,19,22)/t12-/m0/s1 |
| InChIKey | PKKHVRQEHFESDX-LBPRGKRZSA-N |
| XLogP | 2.02 |
| TPSA | 82.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|