C18H29N3OS — CID 131944629
1-[[4-(aminomethyl)phenyl]methyl]-3-(3-cyclohexylsulfanylpropyl)urea (PubChem CID 131944629) has the molecular formula C18H29N3OS and a molecular weight of 335.52 g/mol. Its IUPAC name is 1-[[4-(aminomethyl)phenyl]methyl]-3-(3-cyclohexylsulfanylpropyl)urea.
| Compound Name | 1-[[4-(aminomethyl)phenyl]methyl]-3-(3-cyclohexylsulfanylpropyl)urea |
|---|---|
| PubChem CID | 131944629 |
| Molecular Formula | C18H29N3OS |
| Molecular Weight | 335.52 g/mol |
| Exact Mass | 335.20 |
| IUPAC Name | 1-[[4-(aminomethyl)phenyl]methyl]-3-(3-cyclohexylsulfanylpropyl)urea |
| SMILES | NCc1ccc(CNC(=O)NCCCSC2CCCCC2)cc1 |
| InChI | InChI=1S/C18H29N3OS/c19-13-15-7-9-16(10-8-15)14-21-18(22)20-11-4-12-23-17-5-2-1-3-6-17/h7-10,17H,1-6,11-14,19H2,(H2,20,21,22) |
| InChIKey | URARLMGWOOLNGY-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.52 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|