C17H26N2S2 — CID 100689137
1-(3-cyclohexylsulfanylpropyl)-3-(3-methylphenyl)thiourea (PubChem CID 100689137) has the molecular formula C17H26N2S2 and a molecular weight of 322.54 g/mol. Its IUPAC name is 1-(3-cyclohexylsulfanylpropyl)-3-(3-methylphenyl)thiourea.
| Compound Name | 1-(3-cyclohexylsulfanylpropyl)-3-(3-methylphenyl)thiourea |
|---|---|
| PubChem CID | 100689137 |
| Molecular Formula | C17H26N2S2 |
| Molecular Weight | 322.54 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | 1-(3-cyclohexylsulfanylpropyl)-3-(3-methylphenyl)thiourea |
| SMILES | Cc1cccc(NC(=S)NCCCSC2CCCCC2)c1 |
| InChI | InChI=1S/C17H26N2S2/c1-14-7-5-8-15(13-14)19-17(20)18-11-6-12-21-16-9-3-2-4-10-16/h5,7-8,13,16H,2-4,6,9-12H2,1H3,(H2,18,19,20) |
| InChIKey | TXPDSOHYLPNPOO-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.54 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|