C15H23N3S2 — CID 100603150
1-(2-cyclohexylsulfanylethyl)-3-(5-methyl-2-pyridinyl)thiourea (PubChem CID 100603150) has the molecular formula C15H23N3S2 and a molecular weight of 309.50 g/mol. Its IUPAC name is 1-(2-cyclohexylsulfanylethyl)-3-(5-methyl-2-pyridinyl)thiourea.
| Compound Name | 1-(2-cyclohexylsulfanylethyl)-3-(5-methyl-2-pyridinyl)thiourea |
|---|---|
| PubChem CID | 100603150 |
| Molecular Formula | C15H23N3S2 |
| Molecular Weight | 309.50 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | 1-(2-cyclohexylsulfanylethyl)-3-(5-methyl-2-pyridinyl)thiourea |
| SMILES | Cc1ccc(NC(=S)NCCSC2CCCCC2)nc1 |
| InChI | InChI=1S/C15H23N3S2/c1-12-7-8-14(17-11-12)18-15(19)16-9-10-20-13-5-3-2-4-6-13/h7-8,11,13H,2-6,9-10H2,1H3,(H2,16,17,18,19) |
| InChIKey | CIURPXJZNZQWPH-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.50 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|