C15H20INOS — CID 100528576
N-(2-cyclopentylsulfanylethyl)-2-iodo-4-methylbenzamide (PubChem CID 100528576) has the molecular formula C15H20INOS and a molecular weight of 389.30 g/mol. Its IUPAC name is N-(2-cyclopentylsulfanylethyl)-2-iodo-4-methylbenzamide.
| Compound Name | N-(2-cyclopentylsulfanylethyl)-2-iodo-4-methylbenzamide |
|---|---|
| PubChem CID | 100528576 |
| Molecular Formula | C15H20INOS |
| Molecular Weight | 389.30 g/mol |
| Exact Mass | 389.03 |
| IUPAC Name | N-(2-cyclopentylsulfanylethyl)-2-iodo-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)NCCSC2CCCC2)c(I)c1 |
| InChI | InChI=1S/C15H20INOS/c1-11-6-7-13(14(16)10-11)15(18)17-8-9-19-12-4-2-3-5-12/h6-7,10,12H,2-5,8-9H2,1H3,(H,17,18) |
| InChIKey | NOHPUMCRPGYQAM-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.30 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|