C18H21IN2O — CID 100527914
N-[2-(N,4-dimethylanilino)ethyl]-2-iodo-4-methylbenzamide (PubChem CID 100527914) has the molecular formula C18H21IN2O and a molecular weight of 408.28 g/mol. Its IUPAC name is N-[2-(N,4-dimethylanilino)ethyl]-2-iodo-4-methylbenzamide.
| Compound Name | N-[2-(N,4-dimethylanilino)ethyl]-2-iodo-4-methylbenzamide |
|---|---|
| PubChem CID | 100527914 |
| Molecular Formula | C18H21IN2O |
| Molecular Weight | 408.28 g/mol |
| Exact Mass | 408.07 |
| IUPAC Name | N-[2-(N,4-dimethylanilino)ethyl]-2-iodo-4-methylbenzamide |
| SMILES | Cc1ccc(N(C)CCNC(=O)c2ccc(C)cc2I)cc1 |
| InChI | InChI=1S/C18H21IN2O/c1-13-4-7-15(8-5-13)21(3)11-10-20-18(22)16-9-6-14(2)12-17(16)19/h4-9,12H,10-11H2,1-3H3,(H,20,22) |
| InChIKey | SVOFZBPDQDTTCI-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.28 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|