C17H17ClINOS — CID 100523818
N-[2-[(4-chlorophenyl)methylsulfanyl]ethyl]-2-iodo-4-methylbenzamide (PubChem CID 100523818) has the molecular formula C17H17ClINOS and a molecular weight of 445.75 g/mol. Its IUPAC name is N-[2-[(4-chlorophenyl)methylsulfanyl]ethyl]-2-iodo-4-methylbenzamide.
| Compound Name | N-[2-[(4-chlorophenyl)methylsulfanyl]ethyl]-2-iodo-4-methylbenzamide |
|---|---|
| PubChem CID | 100523818 |
| Molecular Formula | C17H17ClINOS |
| Molecular Weight | 445.75 g/mol |
| Exact Mass | 444.98 |
| IUPAC Name | N-[2-[(4-chlorophenyl)methylsulfanyl]ethyl]-2-iodo-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)NCCSCc2ccc(Cl)cc2)c(I)c1 |
| InChI | InChI=1S/C17H17ClINOS/c1-12-2-7-15(16(19)10-12)17(21)20-8-9-22-11-13-3-5-14(18)6-4-13/h2-7,10H,8-9,11H2,1H3,(H,20,21) |
| InChIKey | QCVXICOFSRRGHD-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.75 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|