C18H27NOS — CID 46778333
N-(2-cyclohexylsulfanylethyl)-2-(2,5-dimethylphenyl)acetamide (PubChem CID 46778333) has the molecular formula C18H27NOS and a molecular weight of 305.49 g/mol. Its IUPAC name is N-(2-cyclohexylsulfanylethyl)-2-(2,5-dimethylphenyl)acetamide.
| Compound Name | N-(2-cyclohexylsulfanylethyl)-2-(2,5-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 46778333 |
| Molecular Formula | C18H27NOS |
| Molecular Weight | 305.49 g/mol |
| Exact Mass | 305.18 |
| IUPAC Name | N-(2-cyclohexylsulfanylethyl)-2-(2,5-dimethylphenyl)acetamide |
| SMILES | Cc1ccc(C)c(CC(=O)NCCSC2CCCCC2)c1 |
| InChI | InChI=1S/C18H27NOS/c1-14-8-9-15(2)16(12-14)13-18(20)19-10-11-21-17-6-4-3-5-7-17/h8-9,12,17H,3-7,10-11,13H2,1-2H3,(H,19,20) |
| InChIKey | CVNQTXWDOCOORL-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.49 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|