C18H28N2O3S2 — CID 126032115
N-(2-cyclohexylsulfanylethyl)-2-(3-methyl-N-methylsulfonylanilino)acetamide (PubChem CID 126032115) has the molecular formula C18H28N2O3S2 and a molecular weight of 384.57 g/mol. Its IUPAC name is N-(2-cyclohexylsulfanylethyl)-2-(3-methyl-N-methylsulfonylanilino)acetamide.
| Compound Name | N-(2-cyclohexylsulfanylethyl)-2-(3-methyl-N-methylsulfonylanilino)acetamide |
|---|---|
| PubChem CID | 126032115 |
| Molecular Formula | C18H28N2O3S2 |
| Molecular Weight | 384.57 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | N-(2-cyclohexylsulfanylethyl)-2-(3-methyl-N-methylsulfonylanilino)acetamide |
| SMILES | Cc1cccc(N(CC(=O)NCCSC2CCCCC2)S(C)(=O)=O)c1 |
| InChI | InChI=1S/C18H28N2O3S2/c1-15-7-6-8-16(13-15)20(25(2,22)23)14-18(21)19-11-12-24-17-9-4-3-5-10-17/h6-8,13,17H,3-5,9-12,14H2,1-2H3,(H,19,21) |
| InChIKey | WTQRVFPISMHREG-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.57 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|