C18H26Cl2N2O3S2 — CID 30226368
N-(3-cyclohexylsulfanylpropyl)-2-(3,4-dichloro-N-methylsulfonylanilino)acetamide (PubChem CID 30226368) has the molecular formula C18H26Cl2N2O3S2 and a molecular weight of 453.46 g/mol. Its IUPAC name is N-(3-cyclohexylsulfanylpropyl)-2-(3,4-dichloro-N-methylsulfonylanilino)acetamide.
| Compound Name | N-(3-cyclohexylsulfanylpropyl)-2-(3,4-dichloro-N-methylsulfonylanilino)acetamide |
|---|---|
| PubChem CID | 30226368 |
| Molecular Formula | C18H26Cl2N2O3S2 |
| Molecular Weight | 453.46 g/mol |
| Exact Mass | 452.08 |
| IUPAC Name | N-(3-cyclohexylsulfanylpropyl)-2-(3,4-dichloro-N-methylsulfonylanilino)acetamide |
| SMILES | CS(=O)(=O)N(CC(=O)NCCCSC1CCCCC1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C18H26Cl2N2O3S2/c1-27(24,25)22(14-8-9-16(19)17(20)12-14)13-18(23)21-10-5-11-26-15-6-3-2-4-7-15/h8-9,12,15H,2-7,10-11,13H2,1H3,(H,21,23) |
| InChIKey | PXBUNNNIGQSFDQ-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.46 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|