C24H29FN2O5S2 — CID 30267049
N-(2-cyclohexylsulfanylethyl)-2-[N-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-3-fluoroanilino]acetamide (PubChem CID 30267049) has the molecular formula C24H29FN2O5S2 and a molecular weight of 508.64 g/mol. Its IUPAC name is N-(2-cyclohexylsulfanylethyl)-2-[N-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-3-fluoroanilino]acetamide.
| Compound Name | N-(2-cyclohexylsulfanylethyl)-2-[N-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-3-fluoroanilino]acetamide |
|---|---|
| PubChem CID | 30267049 |
| Molecular Formula | C24H29FN2O5S2 |
| Molecular Weight | 508.64 g/mol |
| Exact Mass | 508.15 |
| IUPAC Name | N-(2-cyclohexylsulfanylethyl)-2-[N-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-3-fluoroanilino]acetamide |
| SMILES | O=C(CN(c1cccc(F)c1)S(=O)(=O)c1ccc2c(c1)OCCO2)NCCSC1CCCCC1 |
| InChI | InChI=1S/C24H29FN2O5S2/c25-18-5-4-6-19(15-18)27(17-24(28)26-11-14-33-20-7-2-1-3-8-20)34(29,30)21-9-10-22-23(16-21)32-13-12-31-22/h4-6,9-10,15-16,20H,1-3,7-8,11-14,17H2,(H,26,28) |
| InChIKey | KHQNUGSNXNKIFO-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.64 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|