C27H28FN3O5S — CID 30272543
2-[N-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-3-fluoroanilino]-N-[(4-pyrrolidin-1-ylphenyl)methyl]acetamide (PubChem CID 30272543) has the molecular formula C27H28FN3O5S and a molecular weight of 525.60 g/mol. Its IUPAC name is 2-[N-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-3-fluoroanilino]-N-[(4-pyrrolidin-1-ylphenyl)methyl]acetamide.
| Compound Name | 2-[N-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-3-fluoroanilino]-N-[(4-pyrrolidin-1-ylphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 30272543 |
| Molecular Formula | C27H28FN3O5S |
| Molecular Weight | 525.60 g/mol |
| Exact Mass | 525.17 |
| IUPAC Name | 2-[N-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-3-fluoroanilino]-N-[(4-pyrrolidin-1-ylphenyl)methyl]acetamide |
| SMILES | O=C(CN(c1cccc(F)c1)S(=O)(=O)c1ccc2c(c1)OCCO2)NCc1ccc(N2CCCC2)cc1 |
| InChI | InChI=1S/C27H28FN3O5S/c28-21-4-3-5-23(16-21)31(37(33,34)24-10-11-25-26(17-24)36-15-14-35-25)19-27(32)29-18-20-6-8-22(9-7-20)30-12-1-2-13-30/h3-11,16-17H,1-2,12-15,18-19H2,(H,29,32) |
| InChIKey | YEDUEKCOOPWBAM-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.60 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|