C22H18FIN2O5S — CID 43899450
2-[N-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-3-fluoroanilino]-N-(4-iodophenyl)acetamide (PubChem CID 43899450) has the molecular formula C22H18FIN2O5S and a molecular weight of 568.36 g/mol. Its IUPAC name is 2-[N-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-3-fluoroanilino]-N-(4-iodophenyl)acetamide.
| Compound Name | 2-[N-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-3-fluoroanilino]-N-(4-iodophenyl)acetamide |
|---|---|
| PubChem CID | 43899450 |
| Molecular Formula | C22H18FIN2O5S |
| Molecular Weight | 568.36 g/mol |
| Exact Mass | 568.00 |
| IUPAC Name | 2-[N-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-3-fluoroanilino]-N-(4-iodophenyl)acetamide |
| SMILES | O=C(CN(c1cccc(F)c1)S(=O)(=O)c1ccc2c(c1)OCCO2)Nc1ccc(I)cc1 |
| InChI | InChI=1S/C22H18FIN2O5S/c23-15-2-1-3-18(12-15)26(14-22(27)25-17-6-4-16(24)5-7-17)32(28,29)19-8-9-20-21(13-19)31-11-10-30-20/h1-9,12-13H,10-11,14H2,(H,25,27) |
| InChIKey | WTENIDCIIDEVTL-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.36 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|