C20H31N3OS — CID 72902609
N-(3-cyclohexylsulfanylpropyl)-1-pyridin-2-ylpiperidine-3-carboxamide (PubChem CID 72902609) has the molecular formula C20H31N3OS and a molecular weight of 361.56 g/mol. Its IUPAC name is N-(3-cyclohexylsulfanylpropyl)-1-pyridin-2-ylpiperidine-3-carboxamide.
| Compound Name | N-(3-cyclohexylsulfanylpropyl)-1-pyridin-2-ylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 72902609 |
| Molecular Formula | C20H31N3OS |
| Molecular Weight | 361.56 g/mol |
| Exact Mass | 361.22 |
| IUPAC Name | N-(3-cyclohexylsulfanylpropyl)-1-pyridin-2-ylpiperidine-3-carboxamide |
| SMILES | O=C(NCCCSC1CCCCC1)C1CCCN(c2ccccn2)C1 |
| InChI | InChI=1S/C20H31N3OS/c24-20(22-13-7-15-25-18-9-2-1-3-10-18)17-8-6-14-23(16-17)19-11-4-5-12-21-19/h4-5,11-12,17-18H,1-3,6-10,13-16H2,(H,22,24) |
| InChIKey | PISXDKWTOZASPE-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.56 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|