C13H22N4O2 — CID 101216749
4-N,5-N-ditert-butyl-1H-imidazole-4,5-dicarboxamide (PubChem CID 101216749) has the molecular formula C13H22N4O2 and a molecular weight of 266.34 g/mol. Its IUPAC name is 4-N,5-N-ditert-butyl-1H-imidazole-4,5-dicarboxamide.
| Compound Name | 4-N,5-N-ditert-butyl-1H-imidazole-4,5-dicarboxamide |
|---|---|
| PubChem CID | 101216749 |
| Molecular Formula | C13H22N4O2 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | 4-N,5-N-ditert-butyl-1H-imidazole-4,5-dicarboxamide |
| SMILES | CC(C)(C)NC(=O)c1nc[nH]c1C(=O)NC(C)(C)C |
| InChI | InChI=1S/C13H22N4O2/c1-12(2,3)16-10(18)8-9(15-7-14-8)11(19)17-13(4,5)6/h7H,1-6H3,(H,14,15)(H,16,18)(H,17,19) |
| InChIKey | ZGEWQWMJCROETJ-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |