C15H26N4O2 — CID 167791204
4-N,5-N-bis(2-methylbutan-2-yl)-1H-imidazole-4,5-dicarboxamide (PubChem CID 167791204) has the molecular formula C15H26N4O2 and a molecular weight of 294.40 g/mol. Its IUPAC name is 4-N,5-N-bis(2-methylbutan-2-yl)-1H-imidazole-4,5-dicarboxamide.
| Compound Name | 4-N,5-N-bis(2-methylbutan-2-yl)-1H-imidazole-4,5-dicarboxamide |
|---|---|
| PubChem CID | 167791204 |
| Molecular Formula | C15H26N4O2 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.21 |
| IUPAC Name | 4-N,5-N-bis(2-methylbutan-2-yl)-1H-imidazole-4,5-dicarboxamide |
| SMILES | CCC(C)(C)NC(=O)c1nc[nH]c1C(=O)NC(C)(C)CC |
| InChI | InChI=1S/C15H26N4O2/c1-7-14(3,4)18-12(20)10-11(17-9-16-10)13(21)19-15(5,6)8-2/h9H,7-8H2,1-6H3,(H,16,17)(H,18,20)(H,19,21) |
| InChIKey | HLBVPEWJMXGTFQ-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |