C9H14N4O2 — CID 6168
1-ethyl-4-N,5-N-dimethylimidazole-4,5-dicarboxamide (PubChem CID 6168) has the molecular formula C9H14N4O2 and a molecular weight of 210.24 g/mol. Its IUPAC name is 1-ethyl-4-N,5-N-dimethylimidazole-4,5-dicarboxamide.
| Compound Name | 1-ethyl-4-N,5-N-dimethylimidazole-4,5-dicarboxamide |
|---|---|
| PubChem CID | 6168 |
| Molecular Formula | C9H14N4O2 |
| Molecular Weight | 210.24 g/mol |
| Exact Mass | 210.11 |
| IUPAC Name | 1-ethyl-4-N,5-N-dimethylimidazole-4,5-dicarboxamide |
| SMILES | CCn1cnc(C(=O)NC)c1C(=O)NC |
| InChI | InChI=1S/C9H14N4O2/c1-4-13-5-12-6(8(14)10-2)7(13)9(15)11-3/h5H,4H2,1-3H3,(H,10,14)(H,11,15) |
| InChIKey | RYRFAMRQBZNEPX-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.24 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |