C13H15N5O — CID 163239704
N-butyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8,11-pentaene-12-carboxamide (PubChem CID 163239704) has the molecular formula C13H15N5O and a molecular weight of 257.30 g/mol. Its IUPAC name is N-butyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8,11-pentaene-12-carboxamide.
| Compound Name | N-butyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8,11-pentaene-12-carboxamide |
|---|---|
| PubChem CID | 163239704 |
| Molecular Formula | C13H15N5O |
| Molecular Weight | 257.30 g/mol |
| Exact Mass | 257.13 |
| IUPAC Name | N-butyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8,11-pentaene-12-carboxamide |
| SMILES | CCCCNC(=O)c1c[nH]c2ncc3[nH]cnc3c12 |
| InChI | InChI=1S/C13H15N5O/c1-2-3-4-14-13(19)8-5-15-12-10(8)11-9(6-16-12)17-7-18-11/h5-7H,2-4H2,1H3,(H,14,19)(H,15,16)(H,17,18) |
| InChIKey | WXJWVXRQIITGCZ-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.30 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|