C14H18N2O2 — CID 113206507
N-butyl-6-methoxy-1H-indole-3-carboxamide (PubChem CID 113206507) has the molecular formula C14H18N2O2 and a molecular weight of 246.31 g/mol. Its IUPAC name is N-butyl-6-methoxy-1H-indole-3-carboxamide.
| Compound Name | N-butyl-6-methoxy-1H-indole-3-carboxamide |
|---|---|
| PubChem CID | 113206507 |
| Molecular Formula | C14H18N2O2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | N-butyl-6-methoxy-1H-indole-3-carboxamide |
| SMILES | CCCCNC(=O)c1c[nH]c2cc(OC)ccc12 |
| InChI | InChI=1S/C14H18N2O2/c1-3-4-7-15-14(17)12-9-16-13-8-10(18-2)5-6-11(12)13/h5-6,8-9,16H,3-4,7H2,1-2H3,(H,15,17) |
| InChIKey | LDJVPTXJGFAQPU-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|