C16H19N7O — CID 90041169
N-butyl-2-[(5-methylpyrazin-2-yl)amino]-5H-pyrrolo[2,3-b]pyrazine-7-carboxamide (PubChem CID 90041169) has the molecular formula C16H19N7O and a molecular weight of 325.38 g/mol. Its IUPAC name is N-butyl-2-[(5-methylpyrazin-2-yl)amino]-5H-pyrrolo[2,3-b]pyrazine-7-carboxamide.
| Compound Name | N-butyl-2-[(5-methylpyrazin-2-yl)amino]-5H-pyrrolo[2,3-b]pyrazine-7-carboxamide |
|---|---|
| PubChem CID | 90041169 |
| Molecular Formula | C16H19N7O |
| Molecular Weight | 325.38 g/mol |
| Exact Mass | 325.17 |
| IUPAC Name | N-butyl-2-[(5-methylpyrazin-2-yl)amino]-5H-pyrrolo[2,3-b]pyrazine-7-carboxamide |
| SMILES | CCCCNC(=O)c1c[nH]c2ncc(Nc3cnc(C)cn3)nc12 |
| InChI | InChI=1S/C16H19N7O/c1-3-4-5-17-16(24)11-7-20-15-14(11)23-13(9-21-15)22-12-8-18-10(2)6-19-12/h6-9H,3-5H2,1-2H3,(H,17,24)(H,20,21)(H,19,22,23) |
| InChIKey | QIGOZPRGUSLRCL-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 108.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.38 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|