C7H13N5O — CID 110484769
5-amino-N-butyl-2H-triazole-4-carboxamide (PubChem CID 110484769) has the molecular formula C7H13N5O and a molecular weight of 183.22 g/mol. Its IUPAC name is 5-amino-N-butyl-2H-triazole-4-carboxamide.
| Compound Name | 5-amino-N-butyl-2H-triazole-4-carboxamide |
|---|---|
| PubChem CID | 110484769 |
| Molecular Formula | C7H13N5O |
| Molecular Weight | 183.22 g/mol |
| Exact Mass | 183.11 |
| IUPAC Name | 5-amino-N-butyl-2H-triazole-4-carboxamide |
| SMILES | CCCCNC(=O)c1n[nH]nc1N |
| InChI | InChI=1S/C7H13N5O/c1-2-3-4-9-7(13)5-6(8)11-12-10-5/h2-4H2,1H3,(H,9,13)(H3,8,10,11,12) |
| InChIKey | GPSCBGWLDUSFDH-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.22 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|