C15H24N6O2 — CID 171985850
4-N,5-N-bis[(Z)-pentan-2-ylideneamino]-1H-imidazole-4,5-dicarboxamide (PubChem CID 171985850) has the molecular formula C15H24N6O2 and a molecular weight of 320.40 g/mol. Its IUPAC name is 4-N,5-N-bis[(Z)-pentan-2-ylideneamino]-1H-imidazole-4,5-dicarboxamide.
| Compound Name | 4-N,5-N-bis[(Z)-pentan-2-ylideneamino]-1H-imidazole-4,5-dicarboxamide |
|---|---|
| PubChem CID | 171985850 |
| Molecular Formula | C15H24N6O2 |
| Molecular Weight | 320.40 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | 4-N,5-N-bis[(Z)-pentan-2-ylideneamino]-1H-imidazole-4,5-dicarboxamide |
| SMILES | CCC/C(C)=N\NC(=O)c1nc[nH]c1C(=O)N/N=C(/C)CCC |
| InChI | InChI=1S/C15H24N6O2/c1-5-7-10(3)18-20-14(22)12-13(17-9-16-12)15(23)21-19-11(4)8-6-2/h9H,5-8H2,1-4H3,(H,16,17)(H,20,22)(H,21,23)/b18-10-,19-11- |
| InChIKey | MCJMKKHPXQVVLG-BJPQZVBLSA-N |
| XLogP | 2.22 |
| TPSA | 111.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.40 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|