C18H20FIN4O3 — CID 58374880
6-[(2-fluoro-4-iodophenyl)methyl]-1,3-dimethyl-5-(piperazine-1-carbonyl)pyrimidine-2,4-dione (PubChem CID 58374880) has the molecular formula C18H20FIN4O3 and a molecular weight of 486.29 g/mol. Its IUPAC name is 6-[(2-fluoro-4-iodophenyl)methyl]-1,3-dimethyl-5-(piperazine-1-carbonyl)pyrimidine-2,4-dione.
| Compound Name | 6-[(2-fluoro-4-iodophenyl)methyl]-1,3-dimethyl-5-(piperazine-1-carbonyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 58374880 |
| Molecular Formula | C18H20FIN4O3 |
| Molecular Weight | 486.29 g/mol |
| Exact Mass | 486.06 |
| IUPAC Name | 6-[(2-fluoro-4-iodophenyl)methyl]-1,3-dimethyl-5-(piperazine-1-carbonyl)pyrimidine-2,4-dione |
| SMILES | Cn1c(Cc2ccc(I)cc2F)c(C(=O)N2CCNCC2)c(=O)n(C)c1=O |
| InChI | InChI=1S/C18H20FIN4O3/c1-22-14(9-11-3-4-12(20)10-13(11)19)15(16(25)23(2)18(22)27)17(26)24-7-5-21-6-8-24/h3-4,10,21H,5-9H2,1-2H3 |
| InChIKey | BYXKNBITYAQIMH-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 76.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.29 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|