C12H15ClF2N2OS — CID 87713925
S-[(2,4-difluorophenyl)methyl] piperazine-1-carbothioate;hydrochloride (PubChem CID 87713925) has the molecular formula C12H15ClF2N2OS and a molecular weight of 308.78 g/mol. Its IUPAC name is S-[(2,4-difluorophenyl)methyl] piperazine-1-carbothioate;hydrochloride.
| Compound Name | S-[(2,4-difluorophenyl)methyl] piperazine-1-carbothioate;hydrochloride |
|---|---|
| PubChem CID | 87713925 |
| Molecular Formula | C12H15ClF2N2OS |
| Molecular Weight | 308.78 g/mol |
| Exact Mass | 308.06 |
| IUPAC Name | S-[(2,4-difluorophenyl)methyl] piperazine-1-carbothioate;hydrochloride |
| SMILES | Cl.O=C(SCc1ccc(F)cc1F)N1CCNCC1 |
| InChI | InChI=1S/C12H14F2N2OS.ClH/c13-10-2-1-9(11(14)7-10)8-18-12(17)16-5-3-15-4-6-16;/h1-2,7,15H,3-6,8H2;1H |
| InChIKey | OBWKKVWHEBICOP-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.78 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|