C17H13F2IN2O3S — CID 158457810
N-[4-fluoro-5-[(2-fluoro-4-iodophenyl)methyl]-1,3-benzoxazol-6-yl]cyclopropanesulfonamide (PubChem CID 158457810) has the molecular formula C17H13F2IN2O3S and a molecular weight of 490.27 g/mol. Its IUPAC name is N-[4-fluoro-5-[(2-fluoro-4-iodophenyl)methyl]-1,3-benzoxazol-6-yl]cyclopropanesulfonamide.
| Compound Name | N-[4-fluoro-5-[(2-fluoro-4-iodophenyl)methyl]-1,3-benzoxazol-6-yl]cyclopropanesulfonamide |
|---|---|
| PubChem CID | 158457810 |
| Molecular Formula | C17H13F2IN2O3S |
| Molecular Weight | 490.27 g/mol |
| Exact Mass | 489.97 |
| IUPAC Name | N-[4-fluoro-5-[(2-fluoro-4-iodophenyl)methyl]-1,3-benzoxazol-6-yl]cyclopropanesulfonamide |
| SMILES | O=S(=O)(Nc1cc2ocnc2c(F)c1Cc1ccc(I)cc1F)C1CC1 |
| InChI | InChI=1S/C17H13F2IN2O3S/c18-13-6-10(20)2-1-9(13)5-12-14(22-26(23,24)11-3-4-11)7-15-17(16(12)19)21-8-25-15/h1-2,6-8,11,22H,3-5H2 |
| InChIKey | NWBQNPLIEPZVJA-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.27 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|