About 2-[(2S)-2,3-dihydroxypropyl]-8-(2-fluoro-4-methylanilino)-2,6-naphthyridin-1-one
2-[(2S)-2,3-dihydroxypropyl]-8-(2-fluoro-4-methylanilino)-2,6-naphthyridin-1-one (PubChem CID 163456255) has the molecular formula C18H18FN3O3
and a molecular weight of 343.36 g/mol. Its IUPAC name is 2-[(2S)-2,3-dihydroxypropyl]-8-(2-fluoro-4-methylanilino)-2,6-naphthyridin-1-one.
Molecular Properties
| Compound Name | 2-[(2S)-2,3-dihydroxypropyl]-8-(2-fluoro-4-methylanilino)-2,6-naphthyridin-1-one |
| PubChem CID | 163456255 |
| Molecular Formula | C18H18FN3O3 |
| Molecular Weight | 343.36 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | 2-[(2S)-2,3-dihydroxypropyl]-8-(2-fluoro-4-methylanilino)-2,6-naphthyridin-1-one |
| SMILES | Cc1ccc(Nc2cncc3ccn(C[C@H](O)CO)c(=O)c23)c(F)c1 |
| InChI | InChI=1S/C18H18FN3O3/c1-11-2-3-15(14(19)6-11)21-16-8-20-7-12-4-5-22(9-13(24)10-23)18(25)17(12)16/h2-8,13,21,23-24H,9-10H2,1H3/t13-/m0/s1 |
| InChIKey | BKTGFERGEUEVHT-ZDUSSCGKSA-N |
| XLogP | 1.94 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.36 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[(2S)-2,3-dihydroxypropyl]-8-(2-fluoro-4-methylanilino)-2,6-naphthyridin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2S)-2,3-dihydroxypropyl]-8-(2-fluoro-4-methylanilino)-2,6-naphthyridin-1-one?
The IUPAC name of 2-[(2S)-2,3-dihydroxypropyl]-8-(2-fluoro-4-methylanilino)-2,6-naphthyridin-1-one (CID 163456255) is 2-[(2S)-2,3-dihydroxypropyl]-8-(2-fluoro-4-methylanilino)-2,6-naphthyridin-1-one.
What is the SMILES notation for 2-[(2S)-2,3-dihydroxypropyl]-8-(2-fluoro-4-methylanilino)-2,6-naphthyridin-1-one?
The canonical SMILES for 2-[(2S)-2,3-dihydroxypropyl]-8-(2-fluoro-4-methylanilino)-2,6-naphthyridin-1-one is Cc1ccc(Nc2cncc3ccn(C[C@H](O)CO)c(=O)c23)c(F)c1.
What is the InChIKey of 2-[(2S)-2,3-dihydroxypropyl]-8-(2-fluoro-4-methylanilino)-2,6-naphthyridin-1-one?
The InChIKey is BKTGFERGEUEVHT-ZDUSSCGKSA-N. The full InChI is InChI=1S/C18H18FN3O3/c1-11-2-3-15(14(19)6-11)21-16-8-20-7-12-4-5-22(9-13(24)10-23)18(25)17(12)16/h2-8,13,21,23-24H,9-10H2,1H3/t13-/m0/s1.
What are the key properties of 2-[(2S)-2,3-dihydroxypropyl]-8-(2-fluoro-4-methylanilino)-2,6-naphthyridin-1-one?
2-[(2S)-2,3-dihydroxypropyl]-8-(2-fluoro-4-methylanilino)-2,6-naphthyridin-1-one has a molecular weight of 343.36 g/mol, XLogP of 1.94, 5 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2S)-2,3-dihydroxypropyl]-8-(2-fluoro-4-methylanilino)-2,6-naphthyridin-1-one is sourced from PubChem (CID 163456255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).