C15H18FN2OP — CID 169174690
4-[ethyl(methyl)phosphoryl]-N-(2-fluoro-4-methylphenyl)pyridin-3-amine (PubChem CID 169174690) has the molecular formula C15H18FN2OP and a molecular weight of 292.29 g/mol. Its IUPAC name is 4-[ethyl(methyl)phosphoryl]-N-(2-fluoro-4-methylphenyl)pyridin-3-amine.
| Compound Name | 4-[ethyl(methyl)phosphoryl]-N-(2-fluoro-4-methylphenyl)pyridin-3-amine |
|---|---|
| PubChem CID | 169174690 |
| Molecular Formula | C15H18FN2OP |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | 4-[ethyl(methyl)phosphoryl]-N-(2-fluoro-4-methylphenyl)pyridin-3-amine |
| SMILES | CCP(C)(=O)c1ccncc1Nc1ccc(C)cc1F |
| InChI | InChI=1S/C15H18FN2OP/c1-4-20(3,19)15-7-8-17-10-14(15)18-13-6-5-11(2)9-12(13)16/h5-10,18H,4H2,1-3H3 |
| InChIKey | OTOZTEABLWAGKR-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|