C18H27FN4O3S — CID 143564185
5-[(2,3-dihydroxypropylamino)sulfanylamino]-4-(2-fluoro-4-methylanilino)-1-methylpyridin-2-one;ethane (PubChem CID 143564185) has the molecular formula C18H27FN4O3S and a molecular weight of 398.50 g/mol. Its IUPAC name is 5-[(2,3-dihydroxypropylamino)sulfanylamino]-4-(2-fluoro-4-methylanilino)-1-methylpyridin-2-one;ethane.
| Compound Name | 5-[(2,3-dihydroxypropylamino)sulfanylamino]-4-(2-fluoro-4-methylanilino)-1-methylpyridin-2-one;ethane |
|---|---|
| PubChem CID | 143564185 |
| Molecular Formula | C18H27FN4O3S |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | 5-[(2,3-dihydroxypropylamino)sulfanylamino]-4-(2-fluoro-4-methylanilino)-1-methylpyridin-2-one;ethane |
| SMILES | CC.Cc1ccc(Nc2cc(=O)n(C)cc2NSNCC(O)CO)c(F)c1 |
| InChI | InChI=1S/C16H21FN4O3S.C2H6/c1-10-3-4-13(12(17)5-10)19-14-6-16(24)21(2)8-15(14)20-25-18-7-11(23)9-22;1-2/h3-6,8,11,18-20,22-23H,7,9H2,1-2H3;1-2H3 |
| InChIKey | SOQQLALOHDGESX-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 98.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|