C22H28F4N2O3 — CID 143399866
ethane;formaldehyde;3-[1-[3,4,6-trifluoro-2-(2-fluoro-4-methylanilino)anilino]cyclopropyl]propane-1,2-diol (PubChem CID 143399866) has the molecular formula C22H28F4N2O3 and a molecular weight of 444.47 g/mol. Its IUPAC name is ethane;formaldehyde;3-[1-[3,4,6-trifluoro-2-(2-fluoro-4-methylanilino)anilino]cyclopropyl]propane-1,2-diol.
| Compound Name | ethane;formaldehyde;3-[1-[3,4,6-trifluoro-2-(2-fluoro-4-methylanilino)anilino]cyclopropyl]propane-1,2-diol |
|---|---|
| PubChem CID | 143399866 |
| Molecular Formula | C22H28F4N2O3 |
| Molecular Weight | 444.47 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | ethane;formaldehyde;3-[1-[3,4,6-trifluoro-2-(2-fluoro-4-methylanilino)anilino]cyclopropyl]propane-1,2-diol |
| SMILES | C=O.CC.Cc1ccc(Nc2c(F)c(F)cc(F)c2NC2(CC(O)CO)CC2)c(F)c1 |
| InChI | InChI=1S/C19H20F4N2O2.C2H6.CH2O/c1-10-2-3-15(12(20)6-10)24-18-16(23)13(21)7-14(22)17(18)25-19(4-5-19)8-11(27)9-26;2*1-2/h2-3,6-7,11,24-27H,4-5,8-9H2,1H3;1-2H3;1H2 |
| InChIKey | PXPCTAJEBLPCQJ-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.47 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|