C23H28FN3O3Si — CID 162351003
2-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-8-(2-fluoro-4-trimethylsilylanilino)-2,6-naphthyridin-1-one (PubChem CID 162351003) has the molecular formula C23H28FN3O3Si and a molecular weight of 441.58 g/mol. Its IUPAC name is 2-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-8-(2-fluoro-4-trimethylsilylanilino)-2,6-naphthyridin-1-one.
| Compound Name | 2-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-8-(2-fluoro-4-trimethylsilylanilino)-2,6-naphthyridin-1-one |
|---|---|
| PubChem CID | 162351003 |
| Molecular Formula | C23H28FN3O3Si |
| Molecular Weight | 441.58 g/mol |
| Exact Mass | 441.19 |
| IUPAC Name | 2-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-8-(2-fluoro-4-trimethylsilylanilino)-2,6-naphthyridin-1-one |
| SMILES | CC1(C)OC[C@H](Cn2ccc3cncc(Nc4ccc([Si](C)(C)C)cc4F)c3c2=O)O1 |
| InChI | InChI=1S/C23H28FN3O3Si/c1-23(2)29-14-16(30-23)13-27-9-8-15-11-25-12-20(21(15)22(27)28)26-19-7-6-17(10-18(19)24)31(3,4)5/h6-12,16,26H,13-14H2,1-5H3/t16-/m0/s1 |
| InChIKey | RWBAIIZTFFLYMI-INIZCTEOSA-N |
| XLogP | 3.98 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.58 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|