C17H15ClFIN4O3 — CID 24967881
6-chloro-5-(2-fluoro-4-iodoanilino)-3-(2-hydroxypropyl)-8-methylpyrido[2,3-d]pyrimidine-4,7-dione (PubChem CID 24967881) has the molecular formula C17H15ClFIN4O3 and a molecular weight of 504.69 g/mol. Its IUPAC name is 6-chloro-5-(2-fluoro-4-iodoanilino)-3-(2-hydroxypropyl)-8-methylpyrido[2,3-d]pyrimidine-4,7-dione.
| Compound Name | 6-chloro-5-(2-fluoro-4-iodoanilino)-3-(2-hydroxypropyl)-8-methylpyrido[2,3-d]pyrimidine-4,7-dione |
|---|---|
| PubChem CID | 24967881 |
| Molecular Formula | C17H15ClFIN4O3 |
| Molecular Weight | 504.69 g/mol |
| Exact Mass | 503.99 |
| IUPAC Name | 6-chloro-5-(2-fluoro-4-iodoanilino)-3-(2-hydroxypropyl)-8-methylpyrido[2,3-d]pyrimidine-4,7-dione |
| SMILES | CC(O)Cn1cnc2c(c(Nc3ccc(I)cc3F)c(Cl)c(=O)n2C)c1=O |
| InChI | InChI=1S/C17H15ClFIN4O3/c1-8(25)6-24-7-21-15-12(16(24)26)14(13(18)17(27)23(15)2)22-11-4-3-9(20)5-10(11)19/h3-5,7-8,22,25H,6H2,1-2H3 |
| InChIKey | DUGLYBHWPDWDBS-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 89.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.69 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|