C16H17ClFIN2O2 — CID 141242231
ethyl 2-chloro-6-(2-fluoro-4-iodoanilino)-1,3-dimethyl-2H-pyridine-5-carboxylate (PubChem CID 141242231) has the molecular formula C16H17ClFIN2O2 and a molecular weight of 450.68 g/mol. Its IUPAC name is ethyl 2-chloro-6-(2-fluoro-4-iodoanilino)-1,3-dimethyl-2H-pyridine-5-carboxylate.
| Compound Name | ethyl 2-chloro-6-(2-fluoro-4-iodoanilino)-1,3-dimethyl-2H-pyridine-5-carboxylate |
|---|---|
| PubChem CID | 141242231 |
| Molecular Formula | C16H17ClFIN2O2 |
| Molecular Weight | 450.68 g/mol |
| Exact Mass | 450.00 |
| IUPAC Name | ethyl 2-chloro-6-(2-fluoro-4-iodoanilino)-1,3-dimethyl-2H-pyridine-5-carboxylate |
| SMILES | CCOC(=O)C1=C(Nc2ccc(I)cc2F)N(C)C(Cl)C(C)=C1 |
| InChI | InChI=1S/C16H17ClFIN2O2/c1-4-23-16(22)11-7-9(2)14(17)21(3)15(11)20-13-6-5-10(19)8-12(13)18/h5-8,14,20H,4H2,1-3H3 |
| InChIKey | FMRNRQGABDYMNV-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.68 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|