C21H24FIN2O5 — CID 23630801
ethyl 4-(2-fluoro-4-iodoanilino)-1-[2-(oxan-2-yloxy)ethyl]-6-oxopyridine-3-carboxylate (PubChem CID 23630801) has the molecular formula C21H24FIN2O5 and a molecular weight of 530.33 g/mol. Its IUPAC name is ethyl 4-(2-fluoro-4-iodoanilino)-1-[2-(oxan-2-yloxy)ethyl]-6-oxopyridine-3-carboxylate.
| Compound Name | ethyl 4-(2-fluoro-4-iodoanilino)-1-[2-(oxan-2-yloxy)ethyl]-6-oxopyridine-3-carboxylate |
|---|---|
| PubChem CID | 23630801 |
| Molecular Formula | C21H24FIN2O5 |
| Molecular Weight | 530.33 g/mol |
| Exact Mass | 530.07 |
| IUPAC Name | ethyl 4-(2-fluoro-4-iodoanilino)-1-[2-(oxan-2-yloxy)ethyl]-6-oxopyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cn(CCOC2CCCCO2)c(=O)cc1Nc1ccc(I)cc1F |
| InChI | InChI=1S/C21H24FIN2O5/c1-2-28-21(27)15-13-25(8-10-30-20-5-3-4-9-29-20)19(26)12-18(15)24-17-7-6-14(23)11-16(17)22/h6-7,11-13,20,24H,2-5,8-10H2,1H3 |
| InChIKey | NUEIEFXPUKLDIF-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.33 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|