C17H17FIN3O5 — CID 11283221
2-[4-(2-fluoro-4-iodoanilino)-5-(3-hydroxypropylcarbamoyl)-2-oxo-1-pyridinyl]acetic acid (PubChem CID 11283221) has the molecular formula C17H17FIN3O5 and a molecular weight of 489.24 g/mol. Its IUPAC name is 2-[4-(2-fluoro-4-iodoanilino)-5-(3-hydroxypropylcarbamoyl)-2-oxo-1-pyridinyl]acetic acid.
| Compound Name | 2-[4-(2-fluoro-4-iodoanilino)-5-(3-hydroxypropylcarbamoyl)-2-oxo-1-pyridinyl]acetic acid |
|---|---|
| PubChem CID | 11283221 |
| Molecular Formula | C17H17FIN3O5 |
| Molecular Weight | 489.24 g/mol |
| Exact Mass | 489.02 |
| IUPAC Name | 2-[4-(2-fluoro-4-iodoanilino)-5-(3-hydroxypropylcarbamoyl)-2-oxo-1-pyridinyl]acetic acid |
| SMILES | O=C(O)Cn1cc(C(=O)NCCCO)c(Nc2ccc(I)cc2F)cc1=O |
| InChI | InChI=1S/C17H17FIN3O5/c18-12-6-10(19)2-3-13(12)21-14-7-15(24)22(9-16(25)26)8-11(14)17(27)20-4-1-5-23/h2-3,6-8,21,23H,1,4-5,9H2,(H,20,27)(H,25,26) |
| InChIKey | AZSHGWJYZQAVGP-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 120.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.24 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|