C12H12FIN2O4 — CID 146107271
4-[[2-(2-fluoro-4-iodoanilino)-2-oxoacetyl]amino]butanoic acid (PubChem CID 146107271) has the molecular formula C12H12FIN2O4 and a molecular weight of 394.14 g/mol. Its IUPAC name is 4-[[2-(2-fluoro-4-iodoanilino)-2-oxoacetyl]amino]butanoic acid.
| Compound Name | 4-[[2-(2-fluoro-4-iodoanilino)-2-oxoacetyl]amino]butanoic acid |
|---|---|
| PubChem CID | 146107271 |
| Molecular Formula | C12H12FIN2O4 |
| Molecular Weight | 394.14 g/mol |
| Exact Mass | 393.98 |
| IUPAC Name | 4-[[2-(2-fluoro-4-iodoanilino)-2-oxoacetyl]amino]butanoic acid |
| SMILES | O=C(O)CCCNC(=O)C(=O)Nc1ccc(I)cc1F |
| InChI | InChI=1S/C12H12FIN2O4/c13-8-6-7(14)3-4-9(8)16-12(20)11(19)15-5-1-2-10(17)18/h3-4,6H,1-2,5H2,(H,15,19)(H,16,20)(H,17,18) |
| InChIKey | UEZKCLGOEZRXMF-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.14 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|