C16H18FIN4O3 — CID 59991406
4-(2-fluoro-4-iodoanilino)-N-(2-hydroxyethyl)-6-(2-hydroxyethylamino)pyridine-3-carboxamide (PubChem CID 59991406) has the molecular formula C16H18FIN4O3 and a molecular weight of 460.25 g/mol. Its IUPAC name is 4-(2-fluoro-4-iodoanilino)-N-(2-hydroxyethyl)-6-(2-hydroxyethylamino)pyridine-3-carboxamide.
| Compound Name | 4-(2-fluoro-4-iodoanilino)-N-(2-hydroxyethyl)-6-(2-hydroxyethylamino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 59991406 |
| Molecular Formula | C16H18FIN4O3 |
| Molecular Weight | 460.25 g/mol |
| Exact Mass | 460.04 |
| IUPAC Name | 4-(2-fluoro-4-iodoanilino)-N-(2-hydroxyethyl)-6-(2-hydroxyethylamino)pyridine-3-carboxamide |
| SMILES | O=C(NCCO)c1cnc(NCCO)cc1Nc1ccc(I)cc1F |
| InChI | InChI=1S/C16H18FIN4O3/c17-12-7-10(18)1-2-13(12)22-14-8-15(19-3-5-23)21-9-11(14)16(25)20-4-6-24/h1-2,7-9,23-24H,3-6H2,(H,20,25)(H2,19,21,22) |
| InChIKey | JFEGYYFTQASSFO-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 106.51 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.25 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|